C14H15N5O2 — CID 70419755
3-amino-1-N-phenylbenzene-1,2-dicarbohydrazide (PubChem CID 70419755) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-amino-1-N-phenylbenzene-1,2-dicarbohydrazide.
| Compound Name | 3-amino-1-N-phenylbenzene-1,2-dicarbohydrazide |
|---|---|
| PubChem CID | 70419755 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-amino-1-N-phenylbenzene-1,2-dicarbohydrazide |
| SMILES | NNC(=O)c1c(N)cccc1C(=O)N(N)c1ccccc1 |
| InChI | InChI=1S/C14H15N5O2/c15-11-8-4-7-10(12(11)13(20)18-16)14(21)19(17)9-5-2-1-3-6-9/h1-8H,15-17H2,(H,18,20) |
| InChIKey | YIXRLWZKDHAVKE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|