C20H16N6O2 — CID 142958113
N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]furan-2-carboxamide (PubChem CID 142958113) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 142958113 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]furan-2-carboxamide |
| SMILES | [H]/N=C(\c1cccc(NC(=O)c2ccco2)c1)c1cc(-c2ncn[nH]2)ccc1N |
| InChI | InChI=1S/C20H16N6O2/c21-16-7-6-13(19-23-11-24-26-19)10-15(16)18(22)12-3-1-4-14(9-12)25-20(27)17-5-2-8-28-17/h1-11,22H,21H2,(H,25,27)(H,23,24,26)/b22-18+ |
| InChIKey | LWNSREYMMQSGRZ-RELWKKBWSA-N |
| XLogP | 3.32 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|