C11H16FN3 — CID 142959114
(3E)-4-fluoro-2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienenitrile (PubChem CID 142959114) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is (3E)-4-fluoro-2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienenitrile.
| Compound Name | (3E)-4-fluoro-2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142959114 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (3E)-4-fluoro-2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(/F)C(=C)N(C)CCNC |
| InChI | InChI=1S/C11H16FN3/c1-9(8-13)7-11(12)10(2)15(4)6-5-14-3/h7,14H,1-2,5-6H2,3-4H3/b11-7+ |
| InChIKey | NLEPIHBVHXGFJV-YRNVUSSQSA-N |
| XLogP | 1.58 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|