C18H24F3NO3 — CID 142960233
N-[(2R)-2-hydroxypropyl]-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]cyclobutyl]propanamide (PubChem CID 142960233) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]cyclobutyl]propanamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]cyclobutyl]propanamide |
|---|---|
| PubChem CID | 142960233 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]cyclobutyl]propanamide |
| SMILES | C[C@@H](O)CNC(=O)CCC1CC(OCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H24F3NO3/c1-12(23)10-22-17(24)6-5-13-8-16(9-13)25-11-14-3-2-4-15(7-14)18(19,20)21/h2-4,7,12-13,16,23H,5-6,8-11H2,1H3,(H,22,24)/t12-,13?,16?/m1/s1 |
| InChIKey | KDWOBKYZSXAJQJ-VEAWUBTESA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |