C35H41NO7 — CID 142960399
3-O-tert-butyl 5-O-(5-hydroxy-8-methoxy-2,10,10-trimethyl-9H-anthracen-1-yl) (4S,5R)-2,2-dimethyl-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 142960399) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-(5-hydroxy-8-methoxy-2,10,10-trimethyl-9H-anthracen-1-yl) (4S,5R)-2,2-dimethyl-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-(5-hydroxy-8-methoxy-2,10,10-trimethyl-9H-anthracen-1-yl) (4S,5R)-2,2-dimethyl-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 142960399 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 3-O-tert-butyl 5-O-(5-hydroxy-8-methoxy-2,10,10-trimethyl-9H-anthracen-1-yl) (4S,5R)-2,2-dimethyl-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | COc1ccc(O)c2c1Cc1c(ccc(C)c1OC(=O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1c1ccccc1)C2(C)C |
| InChI | InChI=1S/C35H41NO7/c1-20-15-16-24-22(19-23-26(40-9)18-17-25(37)27(23)34(24,5)6)29(20)41-31(38)30-28(21-13-11-10-12-14-21)36(35(7,8)42-30)32(39)43-33(2,3)4/h10-18,28,30,37H,19H2,1-9H3/t28-,30+/m0/s1 |
| InChIKey | DQVPDDBUBMBRCB-MFMCTBQISA-N |
| XLogP | 6.96 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|