C28H26 — CID 142961385
3'-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2'-penta-1,4-dienyl-1,1'-spirobi[indene] (PubChem CID 142961385) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 3'-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2'-penta-1,4-dienyl-1,1'-spirobi[indene].
| Compound Name | 3'-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2'-penta-1,4-dienyl-1,1'-spirobi[indene] |
|---|---|
| PubChem CID | 142961385 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3'-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-2'-penta-1,4-dienyl-1,1'-spirobi[indene] |
| SMILES | C=CCC=CC1=C(C)c2ccccc2C12C(/C=C\C=C/C)=Cc1ccccc12 |
| InChI | InChI=1S/C28H26/c1-4-6-8-15-23-20-22-14-10-12-18-26(22)28(23)25(17-9-7-5-2)21(3)24-16-11-13-19-27(24)28/h4-6,8-20H,2,7H2,1,3H3/b6-4-,15-8-,17-9? |
| InChIKey | CTDXZCHMSAIGGW-BJVSPKLGSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|