C12H20N2O5 — CID 142964462
2-[(2-aminoacetyl)amino]-2-hydroxy-2-[(1E,3E)-octa-1,3-dienoxy]acetic acid (PubChem CID 142964462) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-2-hydroxy-2-[(1E,3E)-octa-1,3-dienoxy]acetic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-2-hydroxy-2-[(1E,3E)-octa-1,3-dienoxy]acetic acid |
|---|---|
| PubChem CID | 142964462 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-2-hydroxy-2-[(1E,3E)-octa-1,3-dienoxy]acetic acid |
| SMILES | CCCC/C=C/C=C/OC(O)(NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C12H20N2O5/c1-2-3-4-5-6-7-8-19-12(18,11(16)17)14-10(15)9-13/h5-8,18H,2-4,9,13H2,1H3,(H,14,15)(H,16,17)/b6-5+,8-7+ |
| InChIKey | XYDVOWUATPOGCN-BSWSSELBSA-N |
| XLogP | 0.07 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|