C20H33NO4 — CID 142965061
1-cyclohexylpyrrolidin-3-ol;2-(3,4-dimethoxyphenyl)ethanol (PubChem CID 142965061) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-cyclohexylpyrrolidin-3-ol;2-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | 1-cyclohexylpyrrolidin-3-ol;2-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 142965061 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-cyclohexylpyrrolidin-3-ol;2-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(CCO)cc1OC.OC1CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C10H19NO.C10H14O3/c12-10-6-7-11(8-10)9-4-2-1-3-5-9;1-12-9-4-3-8(5-6-11)7-10(9)13-2/h9-10,12H,1-8H2;3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | KMZKHFSTAWCHDI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |