C26H30N2O4S — CID 142965251
2-[5-[3-[4-(4,5-dimethyl-1,3-thiazol-2-yl)phenoxy]propoxy]-3-methylindol-1-yl]acetaldehyde;methanol (PubChem CID 142965251) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[5-[3-[4-(4,5-dimethyl-1,3-thiazol-2-yl)phenoxy]propoxy]-3-methylindol-1-yl]acetaldehyde;methanol.
| Compound Name | 2-[5-[3-[4-(4,5-dimethyl-1,3-thiazol-2-yl)phenoxy]propoxy]-3-methylindol-1-yl]acetaldehyde;methanol |
|---|---|
| PubChem CID | 142965251 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[5-[3-[4-(4,5-dimethyl-1,3-thiazol-2-yl)phenoxy]propoxy]-3-methylindol-1-yl]acetaldehyde;methanol |
| SMILES | CO.Cc1nc(-c2ccc(OCCCOc3ccc4c(c3)c(C)cn4CC=O)cc2)sc1C |
| InChI | InChI=1S/C25H26N2O3S.CH4O/c1-17-16-27(11-12-28)24-10-9-22(15-23(17)24)30-14-4-13-29-21-7-5-20(6-8-21)25-26-18(2)19(3)31-25;1-2/h5-10,12,15-16H,4,11,13-14H2,1-3H3;2H,1H3 |
| InChIKey | AUDDYGCBEGFPBR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|