C23H24F3N3O4 — CID 142966475
1-(3-ethoxybenzoyl)-6,7-dimethoxyisoquinoline-4-carboximidamide;1,1,1-trifluoroethane (PubChem CID 142966475) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is 1-(3-ethoxybenzoyl)-6,7-dimethoxyisoquinoline-4-carboximidamide;1,1,1-trifluoroethane.
| Compound Name | 1-(3-ethoxybenzoyl)-6,7-dimethoxyisoquinoline-4-carboximidamide;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 142966475 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-(3-ethoxybenzoyl)-6,7-dimethoxyisoquinoline-4-carboximidamide;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.[H]/N=C(\N)c1cnc(C(=O)c2cccc(OCC)c2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C21H21N3O4.C2H3F3/c1-4-28-13-7-5-6-12(8-13)20(25)19-15-10-18(27-3)17(26-2)9-14(15)16(11-24-19)21(22)23;1-2(3,4)5/h5-11H,4H2,1-3H3,(H3,22,23);1H3 |
| InChIKey | HJESKKYSXXHRBN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|