C22H23N3O4 — CID 21034858
1-(3-ethoxybenzoyl)-6,7-dimethoxy-N'-methylisoquinoline-4-carboximidamide (PubChem CID 21034858) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-(3-ethoxybenzoyl)-6,7-dimethoxy-N'-methylisoquinoline-4-carboximidamide.
| Compound Name | 1-(3-ethoxybenzoyl)-6,7-dimethoxy-N'-methylisoquinoline-4-carboximidamide |
|---|---|
| PubChem CID | 21034858 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(3-ethoxybenzoyl)-6,7-dimethoxy-N'-methylisoquinoline-4-carboximidamide |
| SMILES | CCOc1cccc(C(=O)c2ncc(/C(N)=N/C)c3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-5-29-14-8-6-7-13(9-14)21(26)20-16-11-19(28-4)18(27-3)10-15(16)17(12-25-20)22(23)24-2/h6-12H,5H2,1-4H3,(H2,23,24) |
| InChIKey | FBLFLMPNMUWVQT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|