C23H17NO6 — CID 11200490
1-[3-(furan-2-yl)benzoyl]-6,7-dimethoxyisoquinoline-4-carboxylic acid (PubChem CID 11200490) has the molecular formula C23H17NO6 and a molecular weight of 403.39 g/mol. Its IUPAC name is 1-[3-(furan-2-yl)benzoyl]-6,7-dimethoxyisoquinoline-4-carboxylic acid.
| Compound Name | 1-[3-(furan-2-yl)benzoyl]-6,7-dimethoxyisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 11200490 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-[3-(furan-2-yl)benzoyl]-6,7-dimethoxyisoquinoline-4-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cnc(C(=O)c3cccc(-c4ccco4)c3)c2cc1OC |
| InChI | InChI=1S/C23H17NO6/c1-28-19-10-15-16(11-20(19)29-2)21(24-12-17(15)23(26)27)22(25)14-6-3-5-13(9-14)18-7-4-8-30-18/h3-12H,1-2H3,(H,26,27) |
| InChIKey | HBCMKCCUKFLAPY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |