C21H17F3O8S — CID 87225986
[4-(furan-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl] trifluoromethanesulfonate (PubChem CID 87225986) has the molecular formula C21H17F3O8S and a molecular weight of 486.42 g/mol. Its IUPAC name is [4-(furan-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(furan-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87225986 |
| Molecular Formula | C21H17F3O8S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | [4-(furan-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(C(=O)c2cc(-c3ccco3)ccc2OS(=O)(=O)C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C21H17F3O8S/c1-28-17-10-13(11-18(29-2)20(17)30-3)19(25)14-9-12(15-5-4-8-31-15)6-7-16(14)32-33(26,27)21(22,23)24/h4-11H,1-3H3 |
| InChIKey | OJPFDZDFCKAMTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|