C27H32FN3O5 — CID 142966492
[7,8-dimethoxy-4-(morpholine-4-carboximidoyl)-6H-cyclohepta[c]pyridin-1-yl]-(3-ethoxyphenyl)methanone;fluoromethane (PubChem CID 142966492) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is [7,8-dimethoxy-4-(morpholine-4-carboximidoyl)-6H-cyclohepta[c]pyridin-1-yl]-(3-ethoxyphenyl)methanone;fluoromethane.
| Compound Name | [7,8-dimethoxy-4-(morpholine-4-carboximidoyl)-6H-cyclohepta[c]pyridin-1-yl]-(3-ethoxyphenyl)methanone;fluoromethane |
|---|---|
| PubChem CID | 142966492 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | [7,8-dimethoxy-4-(morpholine-4-carboximidoyl)-6H-cyclohepta[c]pyridin-1-yl]-(3-ethoxyphenyl)methanone;fluoromethane |
| SMILES | CF.[H]/N=C(/c1cnc(C(=O)c2cccc(OCC)c2)c2c1=CCC(OC)=C(OC)C=2)N1CCOCC1 |
| InChI | InChI=1S/C26H29N3O5.CH3F/c1-4-34-18-7-5-6-17(14-18)25(30)24-20-15-23(32-3)22(31-2)9-8-19(20)21(16-28-24)26(27)29-10-12-33-13-11-29;1-2/h5-8,14-16,27H,4,9-13H2,1-3H3;1H3/b27-26-; |
| InChIKey | PTVVHYQXDVPKIP-JTHROIFXSA-N |
| XLogP | 2.42 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|