C22H27NO4S — CID 142967026
2-[[4-[2-[hexyl(hydroxy)amino]-2-oxoethyl]phenyl]sulfanylmethyl]benzoic acid (PubChem CID 142967026) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[[4-[2-[hexyl(hydroxy)amino]-2-oxoethyl]phenyl]sulfanylmethyl]benzoic acid.
| Compound Name | 2-[[4-[2-[hexyl(hydroxy)amino]-2-oxoethyl]phenyl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 142967026 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-[[4-[2-[hexyl(hydroxy)amino]-2-oxoethyl]phenyl]sulfanylmethyl]benzoic acid |
| SMILES | CCCCCCN(O)C(=O)Cc1ccc(SCc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-2-3-4-7-14-23(27)21(24)15-17-10-12-19(13-11-17)28-16-18-8-5-6-9-20(18)22(25)26/h5-6,8-13,27H,2-4,7,14-16H2,1H3,(H,25,26) |
| InChIKey | RJOYBGQUNNUGAD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|