C29H35N8O2+ — CID 142967867
3-[[6-amino-5-[3-methoxy-4-[(1-prop-2-enylindole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium (PubChem CID 142967867) has the molecular formula C29H35N8O2+ and a molecular weight of 527.65 g/mol. Its IUPAC name is 3-[[6-amino-5-[3-methoxy-4-[(1-prop-2-enylindole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium.
| Compound Name | 3-[[6-amino-5-[3-methoxy-4-[(1-prop-2-enylindole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium |
|---|---|
| PubChem CID | 142967867 |
| Molecular Formula | C29H35N8O2+ |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 3-[[6-amino-5-[3-methoxy-4-[(1-prop-2-enylindole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium |
| SMILES | [H]/N=C(\c1ccc(NC(=O)c2cc3ccccc3n2CC=C)c(OC)c1)c1c(N)ncnc1NC(CC)CC[NH3+] |
| InChI | InChI=1S/C29H34N8O2/c1-4-14-37-22-9-7-6-8-18(22)15-23(37)29(38)36-21-11-10-19(16-24(21)39-3)26(31)25-27(32)33-17-34-28(25)35-20(5-2)12-13-30/h4,6-11,15-17,20,31H,1,5,12-14,30H2,2-3H3,(H,36,38)(H3,32,33,34,35)/p+1/b31-26+ |
| InChIKey | QHRVKAXIQQXERB-GKPLWNPISA-O |
| XLogP | 3.70 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|