C32H35N8O2+ — CID 142967885
3-[[6-amino-5-[3-methoxy-4-[(3-phenyl-1H-indole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium (PubChem CID 142967885) has the molecular formula C32H35N8O2+ and a molecular weight of 563.69 g/mol. Its IUPAC name is 3-[[6-amino-5-[3-methoxy-4-[(3-phenyl-1H-indole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium.
| Compound Name | 3-[[6-amino-5-[3-methoxy-4-[(3-phenyl-1H-indole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium |
|---|---|
| PubChem CID | 142967885 |
| Molecular Formula | C32H35N8O2+ |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 3-[[6-amino-5-[3-methoxy-4-[(3-phenyl-1H-indole-2-carbonyl)amino]benzenecarboximidoyl]pyrimidin-4-yl]amino]pentylazanium |
| SMILES | [H]/N=C(\c1ccc(NC(=O)c2[nH]c3ccccc3c2-c2ccccc2)c(OC)c1)c1c(N)ncnc1NC(CC)CC[NH3+] |
| InChI | InChI=1S/C32H34N8O2/c1-3-21(15-16-33)38-31-27(30(35)36-18-37-31)28(34)20-13-14-24(25(17-20)42-2)40-32(41)29-26(19-9-5-4-6-10-19)22-11-7-8-12-23(22)39-29/h4-14,17-18,21,34,39H,3,15-16,33H2,1-2H3,(H,40,41)(H3,35,36,37,38)/p+1/b34-28+ |
| InChIKey | UPCVDLLUABMPJV-CDSHQWRTSA-O |
| XLogP | 4.71 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|