C30H31FN6S — CID 142967877
7-cyclohexyl-5-[4-[[6-(dimethylamino)naphthalen-1-yl]sulfanylamino]-3-fluorophenyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 142967877) has the molecular formula C30H31FN6S and a molecular weight of 526.69 g/mol. Its IUPAC name is 7-cyclohexyl-5-[4-[[6-(dimethylamino)naphthalen-1-yl]sulfanylamino]-3-fluorophenyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-cyclohexyl-5-[4-[[6-(dimethylamino)naphthalen-1-yl]sulfanylamino]-3-fluorophenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142967877 |
| Molecular Formula | C30H31FN6S |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 7-cyclohexyl-5-[4-[[6-(dimethylamino)naphthalen-1-yl]sulfanylamino]-3-fluorophenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ccc2c(SNc3ccc(-c4cn(C5CCCCC5)c5ncnc(N)c45)cc3F)cccc2c1 |
| InChI | InChI=1S/C30H31FN6S/c1-36(2)22-12-13-23-19(15-22)7-6-10-27(23)38-35-26-14-11-20(16-25(26)31)24-17-37(21-8-4-3-5-9-21)30-28(24)29(32)33-18-34-30/h6-7,10-18,21,35H,3-5,8-9H2,1-2H3,(H2,32,33,34) |
| InChIKey | HTCKFXHEWLQSEB-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|