C11H18NO5P — CID 142968601
ethoxy-[[4-[1-(hydroxyamino)ethyl]phenoxy]methyl]phosphinic acid (PubChem CID 142968601) has the molecular formula C11H18NO5P and a molecular weight of 275.24 g/mol. Its IUPAC name is ethoxy-[[4-[1-(hydroxyamino)ethyl]phenoxy]methyl]phosphinic acid.
| Compound Name | ethoxy-[[4-[1-(hydroxyamino)ethyl]phenoxy]methyl]phosphinic acid |
|---|---|
| PubChem CID | 142968601 |
| Molecular Formula | C11H18NO5P |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethoxy-[[4-[1-(hydroxyamino)ethyl]phenoxy]methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)COc1ccc(C(C)NO)cc1 |
| InChI | InChI=1S/C11H18NO5P/c1-3-17-18(14,15)8-16-11-6-4-10(5-7-11)9(2)12-13/h4-7,9,12-13H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | MMGGCLSOMCJLIF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|