C15H28B2NO7P — CID 59809918
N-[1-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]-N-[hydroxy(methyl)boranyl]oxy-methylboronamidic acid (PubChem CID 59809918) has the molecular formula C15H28B2NO7P and a molecular weight of 386.99 g/mol. Its IUPAC name is N-[1-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]-N-[hydroxy(methyl)boranyl]oxy-methylboronamidic acid.
| Compound Name | N-[1-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]-N-[hydroxy(methyl)boranyl]oxy-methylboronamidic acid |
|---|---|
| PubChem CID | 59809918 |
| Molecular Formula | C15H28B2NO7P |
| Molecular Weight | 386.99 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[1-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]-N-[hydroxy(methyl)boranyl]oxy-methylboronamidic acid |
| SMILES | CCOP(=O)(COc1ccc(C(C)N(OB(C)O)B(C)O)cc1)OCC |
| InChI | InChI=1S/C15H28B2NO7P/c1-6-23-26(21,24-7-2)12-22-15-10-8-14(9-11-15)13(3)18(16(4)19)25-17(5)20/h8-11,13,19-20H,6-7,12H2,1-5H3 |
| InChIKey | FDKJQKNXUCJVRU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.99 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|