C19H25N2O5P — CID 143223139
N-(3-amino-4-methylphenyl)-4-(diethoxyphosphorylmethoxy)benzamide (PubChem CID 143223139) has the molecular formula C19H25N2O5P and a molecular weight of 392.39 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-4-(diethoxyphosphorylmethoxy)benzamide.
| Compound Name | N-(3-amino-4-methylphenyl)-4-(diethoxyphosphorylmethoxy)benzamide |
|---|---|
| PubChem CID | 143223139 |
| Molecular Formula | C19H25N2O5P |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-4-(diethoxyphosphorylmethoxy)benzamide |
| SMILES | CCOP(=O)(COc1ccc(C(=O)Nc2ccc(C)c(N)c2)cc1)OCC |
| InChI | InChI=1S/C19H25N2O5P/c1-4-25-27(23,26-5-2)13-24-17-10-7-15(8-11-17)19(22)21-16-9-6-14(3)18(20)12-16/h6-12H,4-5,13,20H2,1-3H3,(H,21,22) |
| InChIKey | ZQSKRWDZHSUOLC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|