C22H22FN5O2 — CID 142969366
7-[(E)-N-[(E)-2-(4-fluorophenyl)ethylideneamino]-C-methylcarbonimidoyl]-5-morpholin-4-yl-1,6-naphthyridin-8-ol (PubChem CID 142969366) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 7-[(E)-N-[(E)-2-(4-fluorophenyl)ethylideneamino]-C-methylcarbonimidoyl]-5-morpholin-4-yl-1,6-naphthyridin-8-ol.
| Compound Name | 7-[(E)-N-[(E)-2-(4-fluorophenyl)ethylideneamino]-C-methylcarbonimidoyl]-5-morpholin-4-yl-1,6-naphthyridin-8-ol |
|---|---|
| PubChem CID | 142969366 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 7-[(E)-N-[(E)-2-(4-fluorophenyl)ethylideneamino]-C-methylcarbonimidoyl]-5-morpholin-4-yl-1,6-naphthyridin-8-ol |
| SMILES | C/C(=N\N=C\Cc1ccc(F)cc1)c1nc(N2CCOCC2)c2cccnc2c1O |
| InChI | InChI=1S/C22H22FN5O2/c1-15(27-25-10-8-16-4-6-17(23)7-5-16)19-21(29)20-18(3-2-9-24-20)22(26-19)28-11-13-30-14-12-28/h2-7,9-10,29H,8,11-14H2,1H3/b25-10+,27-15+ |
| InChIKey | SCGHVXRYCWUHPA-JUYFPDLHSA-N |
| XLogP | 3.35 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|