About 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine
5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine (PubChem CID 15530259) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine.
Molecular Properties
| Compound Name | 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine |
| PubChem CID | 15530259 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine |
| SMILES | C/C=C/Cc1c(N)nc(N2CCOCC2)c2ncccc12 |
| InChI | InChI=1S/C16H20N4O/c1-2-3-5-13-12-6-4-7-18-14(12)16(19-15(13)17)20-8-10-21-11-9-20/h2-4,6-7H,5,8-11H2,1H3,(H2,17,19)/b3-2+ |
| InChIKey | IHHAIMUVZFKVTK-NSCUHMNNSA-N |
| XLogP | 2.17 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine?
The IUPAC name of 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine (CID 15530259) is 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine.
What is the SMILES notation for 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine?
The canonical SMILES for 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine is C/C=C/Cc1c(N)nc(N2CCOCC2)c2ncccc12.
What is the InChIKey of 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine?
The InChIKey is IHHAIMUVZFKVTK-NSCUHMNNSA-N. The full InChI is InChI=1S/C16H20N4O/c1-2-3-5-13-12-6-4-7-18-14(12)16(19-15(13)17)20-8-10-21-11-9-20/h2-4,6-7H,5,8-11H2,1H3,(H2,17,19)/b3-2+.
What are the key properties of 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine?
5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine has a molecular weight of 284.36 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-2-enyl]-8-morpholin-4-yl-1,7-naphthyridin-6-amine is sourced from PubChem (CID 15530259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).