C15H13N3 — CID 66892362
8-[(Z)-prop-1-enyl]benzo[f][1,7]naphthyridin-5-amine (PubChem CID 66892362) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 8-[(Z)-prop-1-enyl]benzo[f][1,7]naphthyridin-5-amine.
| Compound Name | 8-[(Z)-prop-1-enyl]benzo[f][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 66892362 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 8-[(Z)-prop-1-enyl]benzo[f][1,7]naphthyridin-5-amine |
| SMILES | C/C=C\c1ccc2c(c1)nc(N)c1ncccc12 |
| InChI | InChI=1S/C15H13N3/c1-2-4-10-6-7-11-12-5-3-8-17-14(12)15(16)18-13(11)9-10/h2-9H,1H3,(H2,16,18)/b4-2- |
| InChIKey | OKPCNTWUHMZGDC-RQOWECAXSA-N |
| XLogP | 3.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|