C12H21N3O2 — CID 142969707
[[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]-morpholin-4-ylmethanol (PubChem CID 142969707) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is [[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]-morpholin-4-ylmethanol.
| Compound Name | [[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]-morpholin-4-ylmethanol |
|---|---|
| PubChem CID | 142969707 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | [[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]-morpholin-4-ylmethanol |
| SMILES | CNC1=CCC(NC(O)N2CCOCC2)C=C1 |
| InChI | InChI=1S/C12H21N3O2/c1-13-10-2-4-11(5-3-10)14-12(16)15-6-8-17-9-7-15/h2-4,11-14,16H,5-9H2,1H3 |
| InChIKey | LHFAIPUNFIVEKD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|