C19H28N2O2 — CID 86814994
[(1R,4S)-4-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]cyclopent-2-en-1-yl]methanol (PubChem CID 86814994) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(1R,4S)-4-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86814994 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(1R,4S)-4-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]cyclopent-2-en-1-yl]methanol |
| SMILES | CC(N[C@@H]1C=C[C@H](CO)C1)C(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C19H28N2O2/c1-15(20-18-8-7-16(13-18)14-22)19(17-5-3-2-4-6-17)21-9-11-23-12-10-21/h2-8,15-16,18-20,22H,9-14H2,1H3/t15?,16-,18+,19?/m0/s1 |
| InChIKey | IZUWTGSWCQNINA-DPCKTDSQSA-N |
| XLogP | 1.98 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|