C18H31N3O2 — CID 111755508
1-(dimethylamino)-3-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]propan-2-ol (PubChem CID 111755508) has the molecular formula C18H31N3O2 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 111755508 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 1-(dimethylamino)-3-[(1-morpholin-4-yl-1-phenylpropan-2-yl)amino]propan-2-ol |
| SMILES | CC(NCC(O)CN(C)C)C(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H31N3O2/c1-15(19-13-17(22)14-20(2)3)18(16-7-5-4-6-8-16)21-9-11-23-12-10-21/h4-8,15,17-19,22H,9-14H2,1-3H3 |
| InChIKey | DPODDMYSRXBPSX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |