C9H12OS — CID 142969855
(3Z)-3-ethenyl-4-methylsulfanylhexa-3,5-dien-2-one (PubChem CID 142969855) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is (3Z)-3-ethenyl-4-methylsulfanylhexa-3,5-dien-2-one.
| Compound Name | (3Z)-3-ethenyl-4-methylsulfanylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142969855 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (3Z)-3-ethenyl-4-methylsulfanylhexa-3,5-dien-2-one |
| SMILES | C=C/C(SC)=C(\C=C)C(C)=O |
| InChI | InChI=1S/C9H12OS/c1-5-8(7(3)10)9(6-2)11-4/h5-6H,1-2H2,3-4H3/b9-8- |
| InChIKey | QOZMGIRQJDNCRH-HJWRWDBZSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|