C9H12S — CID 142108802
3-ethenyl-4-methylsulfanylhexa-1,3,5-triene (PubChem CID 142108802) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is 3-ethenyl-4-methylsulfanylhexa-1,3,5-triene.
| Compound Name | 3-ethenyl-4-methylsulfanylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142108802 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-ethenyl-4-methylsulfanylhexa-1,3,5-triene |
| SMILES | C=CC(C=C)=C(C=C)SC |
| InChI | InChI=1S/C9H12S/c1-5-8(6-2)9(7-3)10-4/h5-7H,1-3H2,4H3 |
| InChIKey | SGVXHTQBMRDGNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|