C24H34FNO3S — CID 142970880
(Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol;ethane (PubChem CID 142970880) has the molecular formula C24H34FNO3S and a molecular weight of 435.61 g/mol. Its IUPAC name is (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol;ethane.
| Compound Name | (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol;ethane |
|---|---|
| PubChem CID | 142970880 |
| Molecular Formula | C24H34FNO3S |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol;ethane |
| SMILES | CC.CC.CC(C)(C)/C=N/C(=C(\O)c1ccc(S(C)(=O)=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO3S.2C2H6/c1-20(2,3)13-22-18(14-5-9-16(21)10-6-14)19(23)15-7-11-17(12-8-15)26(4,24)25;2*1-2/h5-13,23H,1-4H3;2*1-2H3/b19-18-,22-13+;; |
| InChIKey | XEBNFMQBQLPVFX-JGFRWTRGSA-N |
| XLogP | 6.78 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|