About ethane;(1-methylcyclohexyl) cyanate;propane
ethane;(1-methylcyclohexyl) cyanate;propane (PubChem CID 142970987) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is ethane;(1-methylcyclohexyl) cyanate;propane.
Molecular Properties
| Compound Name | ethane;(1-methylcyclohexyl) cyanate;propane |
| PubChem CID | 142970987 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;(1-methylcyclohexyl) cyanate;propane |
| SMILES | CC.CC1(OC#N)CCCCC1.CCC |
| InChI | InChI=1S/C8H13NO.C3H8.C2H6/c1-8(10-7-9)5-3-2-4-6-8;1-3-2;1-2/h2-6H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | BXTUGVFHBDLQMY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1-methylcyclohexyl) cyanate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1-methylcyclohexyl) cyanate;propane?
The IUPAC name of ethane;(1-methylcyclohexyl) cyanate;propane (CID 142970987) is ethane;(1-methylcyclohexyl) cyanate;propane.
What is the SMILES notation for ethane;(1-methylcyclohexyl) cyanate;propane?
The canonical SMILES for ethane;(1-methylcyclohexyl) cyanate;propane is CC.CC1(OC#N)CCCCC1.CCC.
What is the InChIKey of ethane;(1-methylcyclohexyl) cyanate;propane?
The InChIKey is BXTUGVFHBDLQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C3H8.C2H6/c1-8(10-7-9)5-3-2-4-6-8;1-3-2;1-2/h2-6H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;(1-methylcyclohexyl) cyanate;propane?
ethane;(1-methylcyclohexyl) cyanate;propane has a molecular weight of 213.36 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1-methylcyclohexyl) cyanate;propane is sourced from PubChem (CID 142970987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).