C19H25BrN4O2 — CID 142971336
5-bromo-N-[(2S)-3-cyclohexyl-1-(dimethylamino)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 142971336) has the molecular formula C19H25BrN4O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-3-cyclohexyl-1-(dimethylamino)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-3-cyclohexyl-1-(dimethylamino)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142971336 |
| Molecular Formula | C19H25BrN4O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 5-bromo-N-[(2S)-3-cyclohexyl-1-(dimethylamino)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H](CC1CCCCC1)NC(=O)c1cc2cc(Br)ncc2[nH]1 |
| InChI | InChI=1S/C19H25BrN4O2/c1-24(2)19(26)15(8-12-6-4-3-5-7-12)23-18(25)14-9-13-10-17(20)21-11-16(13)22-14/h9-12,15,22H,3-8H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | PFJQGVGQTHZAAR-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|