C20H26CoN2O3+ — CID 156883927
carbanide;cobalt(3+);(2R)-3-cyclohexyl-2-[(7-methanidyl-1H-indole-2-carbonyl)amino]propanoic acid (PubChem CID 156883927) has the molecular formula C20H26CoN2O3+ and a molecular weight of 401.37 g/mol. Its IUPAC name is carbanide;cobalt(3+);(2R)-3-cyclohexyl-2-[(7-methanidyl-1H-indole-2-carbonyl)amino]propanoic acid.
| Compound Name | carbanide;cobalt(3+);(2R)-3-cyclohexyl-2-[(7-methanidyl-1H-indole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 156883927 |
| Molecular Formula | C20H26CoN2O3+ |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | carbanide;cobalt(3+);(2R)-3-cyclohexyl-2-[(7-methanidyl-1H-indole-2-carbonyl)amino]propanoic acid |
| SMILES | [CH2-]c1cccc2cc(C(=O)N[C@H](CC3CCCCC3)C(=O)O)[nH]c12.[CH3-].[Co+3] |
| InChI | InChI=1S/C19H23N2O3.CH3.Co/c1-12-6-5-9-14-11-15(20-17(12)14)18(22)21-16(19(23)24)10-13-7-3-2-4-8-13;;/h5-6,9,11,13,16,20H,1-4,7-8,10H2,(H,21,22)(H,23,24);1H3;/q2*-1;+3/t16-;;/m1../s1 |
| InChIKey | ZSLTWDHUVHNJRQ-GGMCWBHBSA-N |
| XLogP | 3.95 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|