C11H18O2 — CID 14297181
(E)-1-(2,3-dimethyloxiran-2-yl)hept-2-en-1-one (PubChem CID 14297181) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (E)-1-(2,3-dimethyloxiran-2-yl)hept-2-en-1-one.
| Compound Name | (E)-1-(2,3-dimethyloxiran-2-yl)hept-2-en-1-one |
|---|---|
| PubChem CID | 14297181 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (E)-1-(2,3-dimethyloxiran-2-yl)hept-2-en-1-one |
| SMILES | CCCC/C=C/C(=O)C1(C)OC1C |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-7-8-10(12)11(3)9(2)13-11/h7-9H,4-6H2,1-3H3/b8-7+ |
| InChIKey | VBTKESCDFIIABI-BQYQJAHWSA-N |
| XLogP | 2.48 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|