About 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate
1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate (PubChem CID 158830827) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate.
Molecular Properties
| Compound Name | 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate |
| PubChem CID | 158830827 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate |
| SMILES | C/C=C/C(C)=O.CC(=O)C1OC1C.O |
| InChI | InChI=1S/C5H8O2.C5H8O.H2O/c1-3(6)5-4(2)7-5;1-3-4-5(2)6;/h4-5H,1-2H3;3-4H,1-2H3;1H2/b;4-3+; |
| InChIKey | INZZHEJZGKSUPI-ITDJAWRYSA-N |
| XLogP | 0.69 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate?
The IUPAC name of 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate (CID 158830827) is 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate.
What is the SMILES notation for 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate?
The canonical SMILES for 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate is C/C=C/C(C)=O.CC(=O)C1OC1C.O.
What is the InChIKey of 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate?
The InChIKey is INZZHEJZGKSUPI-ITDJAWRYSA-N. The full InChI is InChI=1S/C5H8O2.C5H8O.H2O/c1-3(6)5-4(2)7-5;1-3-4-5(2)6;/h4-5H,1-2H3;3-4H,1-2H3;1H2/b;4-3+;.
What are the key properties of 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate?
1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate has a molecular weight of 202.25 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyloxiran-2-yl)ethanone;(E)-pent-3-en-2-one;hydrate is sourced from PubChem (CID 158830827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).