C10H16O3 — CID 158830826
1-[(2R,3S)-3-methyloxiran-2-yl]ethanone;(E)-pent-3-en-2-one (PubChem CID 158830826) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-[(2R,3S)-3-methyloxiran-2-yl]ethanone;(E)-pent-3-en-2-one.
| Compound Name | 1-[(2R,3S)-3-methyloxiran-2-yl]ethanone;(E)-pent-3-en-2-one |
|---|---|
| PubChem CID | 158830826 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-[(2R,3S)-3-methyloxiran-2-yl]ethanone;(E)-pent-3-en-2-one |
| SMILES | C/C=C/C(C)=O.CC(=O)[C@@H]1O[C@H]1C |
| InChI | InChI=1S/C5H8O2.C5H8O/c1-3(6)5-4(2)7-5;1-3-4-5(2)6/h4-5H,1-2H3;3-4H,1-2H3/b;4-3+/t4-,5-;/m0./s1 |
| InChIKey | IXAGSPOIGQYCGN-LAKVMEQBSA-N |
| XLogP | 1.51 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|