C8H12O2 — CID 23257927
(E)-1-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-2-en-1-one (PubChem CID 23257927) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (E)-1-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 23257927 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (E)-1-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)[C@@]1(C)O[C@H]1C |
| InChI | InChI=1S/C8H12O2/c1-4-5-7(9)8(3)6(2)10-8/h4-6H,1-3H3/b5-4+/t6-,8-/m0/s1 |
| InChIKey | HFAZNWUYWKVDIU-SCLBYUHSSA-N |
| XLogP | 1.31 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|