C24H34N2 — CID 142975296
N,2-dimethyl-4-[(Z)-1-(methylideneamino)prop-1-enyl]-N-(2-methylphenyl)aniline;ethane;prop-1-ene (PubChem CID 142975296) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is N,2-dimethyl-4-[(Z)-1-(methylideneamino)prop-1-enyl]-N-(2-methylphenyl)aniline;ethane;prop-1-ene.
| Compound Name | N,2-dimethyl-4-[(Z)-1-(methylideneamino)prop-1-enyl]-N-(2-methylphenyl)aniline;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142975296 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | N,2-dimethyl-4-[(Z)-1-(methylideneamino)prop-1-enyl]-N-(2-methylphenyl)aniline;ethane;prop-1-ene |
| SMILES | C=CC.C=N/C(=C\C)c1ccc(N(C)c2ccccc2C)c(C)c1.CC |
| InChI | InChI=1S/C19H22N2.C3H6.C2H6/c1-6-17(20-4)16-11-12-19(15(3)13-16)21(5)18-10-8-7-9-14(18)2;1-3-2;1-2/h6-13H,4H2,1-3,5H3;3H,1H2,2H3;1-2H3/b17-6-;; |
| InChIKey | WWFZCZMRZCKORC-QMNZVVPRSA-N |
| XLogP | 7.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|