C27H38FN3O3 — CID 142976559
2-(4-fluorophenyl)-N-heptyl-N-(4-piperidin-1-ylphenyl)acetamide;N-hydroxyformamide (PubChem CID 142976559) has the molecular formula C27H38FN3O3 and a molecular weight of 471.62 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-heptyl-N-(4-piperidin-1-ylphenyl)acetamide;N-hydroxyformamide.
| Compound Name | 2-(4-fluorophenyl)-N-heptyl-N-(4-piperidin-1-ylphenyl)acetamide;N-hydroxyformamide |
|---|---|
| PubChem CID | 142976559 |
| Molecular Formula | C27H38FN3O3 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 2-(4-fluorophenyl)-N-heptyl-N-(4-piperidin-1-ylphenyl)acetamide;N-hydroxyformamide |
| SMILES | CCCCCCCN(C(=O)Cc1ccc(F)cc1)c1ccc(N2CCCCC2)cc1.O=CNO |
| InChI | InChI=1S/C26H35FN2O.CH3NO2/c1-2-3-4-5-9-20-29(26(30)21-22-10-12-23(27)13-11-22)25-16-14-24(15-17-25)28-18-7-6-8-19-28;3-1-2-4/h10-17H,2-9,18-21H2,1H3;1,4H,(H,2,3) |
| InChIKey | QRDPHFUWXUPXJK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|