C27H35N5OS — CID 142977169
4-(azepan-1-yl)-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazoline (PubChem CID 142977169) has the molecular formula C27H35N5OS and a molecular weight of 477.68 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazoline.
| Compound Name | 4-(azepan-1-yl)-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazoline |
|---|---|
| PubChem CID | 142977169 |
| Molecular Formula | C27H35N5OS |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 4-(azepan-1-yl)-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazoline |
| SMILES | COc1ccc(SN2CCN(C(C)c3nc(N4CCCCCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H35N5OS/c1-21(30-17-19-32(20-18-30)34-23-13-11-22(33-2)12-14-23)26-28-25-10-6-5-9-24(25)27(29-26)31-15-7-3-4-8-16-31/h5-6,9-14,21H,3-4,7-8,15-20H2,1-2H3 |
| InChIKey | HRBCVWHJAGVKJE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|