C23H29N5OS — CID 142977189
N-ethyl-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 142977189) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is N-ethyl-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-ethyl-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142977189 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-ethyl-2-[1-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | CCNc1nc(C(C)N2CCN(Sc3ccc(OC)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H29N5OS/c1-4-24-23-20-7-5-6-8-21(20)25-22(26-23)17(2)27-13-15-28(16-14-27)30-19-11-9-18(29-3)10-12-19/h5-12,17H,4,13-16H2,1-3H3,(H,24,25,26) |
| InChIKey | UEZOXQNGQCMCTI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|