C16H12ClN3O5S — CID 142978689
2-[2-[[(2-chloro-6H-thieno[2,3-b]pyrrole-5-carbonyl)amino]carbamoyl]phenoxy]acetic acid (PubChem CID 142978689) has the molecular formula C16H12ClN3O5S and a molecular weight of 393.81 g/mol. Its IUPAC name is 2-[2-[[(2-chloro-6H-thieno[2,3-b]pyrrole-5-carbonyl)amino]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[(2-chloro-6H-thieno[2,3-b]pyrrole-5-carbonyl)amino]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142978689 |
| Molecular Formula | C16H12ClN3O5S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-[2-[[(2-chloro-6H-thieno[2,3-b]pyrrole-5-carbonyl)amino]carbamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C(=O)NNC(=O)c1cc2cc(Cl)sc2[nH]1 |
| InChI | InChI=1S/C16H12ClN3O5S/c17-12-6-8-5-10(18-16(8)26-12)15(24)20-19-14(23)9-3-1-2-4-11(9)25-7-13(21)22/h1-6,18H,7H2,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | SSNFJXKAJXYLCT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|