C16H19NOS — CID 142980228
N-[methylidene-[4-(4-methylphenyl)phenyl]-oxo-λ6-sulfanyl]ethanamine (PubChem CID 142980228) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[methylidene-[4-(4-methylphenyl)phenyl]-oxo-λ6-sulfanyl]ethanamine.
| Compound Name | N-[methylidene-[4-(4-methylphenyl)phenyl]-oxo-λ6-sulfanyl]ethanamine |
|---|---|
| PubChem CID | 142980228 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[methylidene-[4-(4-methylphenyl)phenyl]-oxo-λ6-sulfanyl]ethanamine |
| SMILES | C=S(=O)(NCC)c1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H19NOS/c1-4-17-19(3,18)16-11-9-15(10-12-16)14-7-5-13(2)6-8-14/h5-12H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | KJUADWKDRGWMLS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|