C25H21ClF2N2O3 — CID 142982522
(4-chloro-2-fluorophenyl)-[3-[2-(4-fluoroanilino)-2-hydroxyethyl]-5-methoxy-2-methylindol-1-yl]methanone (PubChem CID 142982522) has the molecular formula C25H21ClF2N2O3 and a molecular weight of 470.90 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-[3-[2-(4-fluoroanilino)-2-hydroxyethyl]-5-methoxy-2-methylindol-1-yl]methanone.
| Compound Name | (4-chloro-2-fluorophenyl)-[3-[2-(4-fluoroanilino)-2-hydroxyethyl]-5-methoxy-2-methylindol-1-yl]methanone |
|---|---|
| PubChem CID | 142982522 |
| Molecular Formula | C25H21ClF2N2O3 |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-[3-[2-(4-fluoroanilino)-2-hydroxyethyl]-5-methoxy-2-methylindol-1-yl]methanone |
| SMILES | COc1ccc2c(c1)c(CC(O)Nc1ccc(F)cc1)c(C)n2C(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C25H21ClF2N2O3/c1-14-20(13-24(31)29-17-6-4-16(27)5-7-17)21-12-18(33-2)8-10-23(21)30(14)25(32)19-9-3-15(26)11-22(19)28/h3-12,24,29,31H,13H2,1-2H3 |
| InChIKey | LYJGHWCFPJUERN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|