C26H37N3O2S — CID 142983032
N-(2-tert-butylphenyl)-2-(1-hexanoylpiperidin-4-yl)-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 142983032) has the molecular formula C26H37N3O2S and a molecular weight of 455.67 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-(1-hexanoylpiperidin-4-yl)-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2-(1-hexanoylpiperidin-4-yl)-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142983032 |
| Molecular Formula | C26H37N3O2S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-(1-hexanoylpiperidin-4-yl)-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCC(=O)N1CCC(c2nc(C(=O)N(C)c3ccccc3C(C)(C)C)cs2)CC1 |
| InChI | InChI=1S/C26H37N3O2S/c1-6-7-8-13-23(30)29-16-14-19(15-17-29)24-27-21(18-32-24)25(31)28(5)22-12-10-9-11-20(22)26(2,3)4/h9-12,18-19H,6-8,13-17H2,1-5H3 |
| InChIKey | VJLFDELHQKRMIC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|