C24H37NO3 — CID 142985284
acetaldehyde;(8S,10R,11S,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol (PubChem CID 142985284) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is acetaldehyde;(8S,10R,11S,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol.
| Compound Name | acetaldehyde;(8S,10R,11S,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol |
|---|---|
| PubChem CID | 142985284 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | acetaldehyde;(8S,10R,11S,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol |
| SMILES | CC=O.[H]/N=C1\C=C[C@@]2(C)C(=C1)CC[C@@H]1C2C(O)C[C@@]2(C)C1C[C@H](C)[C@]2(O)CC |
| InChI | InChI=1S/C22H33NO2.C2H4O/c1-5-22(25)13(2)10-17-16-7-6-14-11-15(23)8-9-20(14,3)19(16)18(24)12-21(17,22)4;1-2-3/h8-9,11,13,16-19,23-25H,5-7,10,12H2,1-4H3;2H,1H3/b23-15+;/t13-,16-,17?,18?,19?,20-,21-,22+;/m0./s1 |
| InChIKey | GTOFWRMYMWDNRB-BUIJHRAKSA-N |
| XLogP | 4.31 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|