C22H33NO2 — CID 142985285
(8S,10R,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol (PubChem CID 142985285) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (8S,10R,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol.
| Compound Name | (8S,10R,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol |
|---|---|
| PubChem CID | 142985285 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (8S,10R,13S,16S,17R)-17-ethyl-3-imino-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-11,17-diol |
| SMILES | [H]/N=C1\C=C[C@@]2(C)C(=C1)CC[C@@H]1C2C(O)C[C@@]2(C)C1C[C@H](C)[C@]2(O)CC |
| InChI | InChI=1S/C22H33NO2/c1-5-22(25)13(2)10-17-16-7-6-14-11-15(23)8-9-20(14,3)19(16)18(24)12-21(17,22)4/h8-9,11,13,16-19,23-25H,5-7,10,12H2,1-4H3/b23-15+/t13-,16-,17?,18?,19?,20-,21-,22+/m0/s1 |
| InChIKey | YWYLDOMDLYVMLB-SBDGFFBHSA-N |
| XLogP | 4.10 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|