C6H10NO+ — CID 142986038
(4-hydroxycyclohexa-1,3-dien-1-yl)azanium (PubChem CID 142986038) has the molecular formula C6H10NO+ and a molecular weight of 112.15 g/mol. Its IUPAC name is (4-hydroxycyclohexa-1,3-dien-1-yl)azanium.
| Compound Name | (4-hydroxycyclohexa-1,3-dien-1-yl)azanium |
|---|---|
| PubChem CID | 142986038 |
| Molecular Formula | C6H10NO+ |
| Molecular Weight | 112.15 g/mol |
| Exact Mass | 112.08 |
| IUPAC Name | (4-hydroxycyclohexa-1,3-dien-1-yl)azanium |
| SMILES | [NH3+]C1=CC=C(O)CC1 |
| InChI | InChI=1S/C6H9NO/c7-5-1-3-6(8)4-2-5/h1,3,8H,2,4,7H2/p+1 |
| InChIKey | AJYVFMIKVDVFIW-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.15 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |