C7H10FNO — CID 143768450
4-amino-3-fluoro-5-methylcyclohexa-1,3-dien-1-ol (PubChem CID 143768450) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is 4-amino-3-fluoro-5-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | 4-amino-3-fluoro-5-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143768450 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 4-amino-3-fluoro-5-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1CC(O)=CC(F)=C1N |
| InChI | InChI=1S/C7H10FNO/c1-4-2-5(10)3-6(8)7(4)9/h3-4,10H,2,9H2,1H3 |
| InChIKey | SMXMOLSCUGURIN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |