C8H13NO — CID 155216895
(6R)-4-amino-6-ethylcyclohexa-1,3-dien-1-ol (PubChem CID 155216895) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (6R)-4-amino-6-ethylcyclohexa-1,3-dien-1-ol.
| Compound Name | (6R)-4-amino-6-ethylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 155216895 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (6R)-4-amino-6-ethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC[C@@H]1CC(N)=CC=C1O |
| InChI | InChI=1S/C8H13NO/c1-2-6-5-7(9)3-4-8(6)10/h3-4,6,10H,2,5,9H2,1H3/t6-/m1/s1 |
| InChIKey | XSQAKSUYRKKKIF-ZCFIWIBFSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |